N-(3,5-dimethylphenyl)-6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide
N-(3,5-dimethylphenyl)-6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide
Compound characteristics
| Compound ID: | M810-1665 |
| Compound Name: | N-(3,5-dimethylphenyl)-6-ethyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide |
| Molecular Weight: | 350.46 |
| Molecular Formula: | C15 H18 N4 O2 S2 |
| Smiles: | CCc1c(n2c(n1)sc(C)n2)S(Nc1cc(C)cc(C)c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0783 |
| logD: | 3.0719 |
| logSw: | -3.2403 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.941 |
| InChI Key: | GYXMAPKXZYYTDD-UHFFFAOYSA-N |