N-(2-ethylphenyl)-2-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-2-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide
N-(2-ethylphenyl)-2-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide
Compound characteristics
| Compound ID: | M815-0008 |
| Compound Name: | N-(2-ethylphenyl)-2-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]acetamide |
| Molecular Weight: | 390.48 |
| Molecular Formula: | C23 H26 N4 O2 |
| Smiles: | CCc1ccccc1NC(CN1CCC(CC1)c1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.176 |
| logD: | 5.1156 |
| logSw: | -4.9247 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.828 |
| InChI Key: | NBXFAVWYGDEDQC-UHFFFAOYSA-N |