2-{4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}-N-(4-methylphenyl)acetamide
Chemical Structure Depiction of
2-{4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}-N-(4-methylphenyl)acetamide
2-{4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}-N-(4-methylphenyl)acetamide
Compound characteristics
| Compound ID: | M815-0408 |
| Compound Name: | 2-{4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}-N-(4-methylphenyl)acetamide |
| Molecular Weight: | 394.45 |
| Molecular Formula: | C22 H23 F N4 O2 |
| Smiles: | Cc1ccc(cc1)NC(CN1CCC(CC1)c1nc(c2ccc(cc2)F)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2339 |
| logD: | 5.2217 |
| logSw: | -5.008 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.526 |
| InChI Key: | LGSAZLXINAHKHU-UHFFFAOYSA-N |