1-{[1-(2,3-dihydro-1H-indene-5-sulfonyl)piperidin-4-yl]methyl}azepane
Chemical Structure Depiction of
1-{[1-(2,3-dihydro-1H-indene-5-sulfonyl)piperidin-4-yl]methyl}azepane
1-{[1-(2,3-dihydro-1H-indene-5-sulfonyl)piperidin-4-yl]methyl}azepane
Compound characteristics
| Compound ID: | M857-0072 |
| Compound Name: | 1-{[1-(2,3-dihydro-1H-indene-5-sulfonyl)piperidin-4-yl]methyl}azepane |
| Molecular Weight: | 376.56 |
| Molecular Formula: | C21 H32 N2 O2 S |
| Smiles: | C1CCCN(CC1)CC1CCN(CC1)S(c1ccc2CCCc2c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.53 |
| logD: | 1.6175 |
| logSw: | -4.301 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.3 |
| InChI Key: | NKCQNHDYKDDNKO-UHFFFAOYSA-N |