3-(3-fluorophenyl)-5-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(3-fluorophenyl)-5-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-1,2,4-oxadiazole
3-(3-fluorophenyl)-5-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | M876-0149 |
| Compound Name: | 3-(3-fluorophenyl)-5-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-1,2,4-oxadiazole |
| Molecular Weight: | 340.29 |
| Molecular Formula: | C17 H10 F2 N4 O2 |
| Smiles: | C(c1nnc(c2ccc(cc2)F)o1)c1nc(c2cccc(c2)F)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.0129 |
| logD: | 4.0129 |
| logSw: | -4.3826 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 61.491 |
| InChI Key: | PASFFHYHXPYWBK-UHFFFAOYSA-N |