N-(3-chloro-2-fluorophenyl)-N'-{3-[6-(morpholin-4-yl)pyridazin-3-yl]phenyl}urea
Chemical Structure Depiction of
N-(3-chloro-2-fluorophenyl)-N'-{3-[6-(morpholin-4-yl)pyridazin-3-yl]phenyl}urea
N-(3-chloro-2-fluorophenyl)-N'-{3-[6-(morpholin-4-yl)pyridazin-3-yl]phenyl}urea
Compound characteristics
| Compound ID: | M923-1210 |
| Compound Name: | N-(3-chloro-2-fluorophenyl)-N'-{3-[6-(morpholin-4-yl)pyridazin-3-yl]phenyl}urea |
| Molecular Weight: | 427.86 |
| Molecular Formula: | C21 H19 Cl F N5 O2 |
| Smiles: | C1COCCN1c1ccc(c2cccc(c2)NC(Nc2cccc(c2F)[Cl])=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.6597 |
| logD: | 4.6583 |
| logSw: | -4.9232 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.14 |
| InChI Key: | IVJUDTGYMWOJOA-UHFFFAOYSA-N |