N-(2-phenylethyl)-N'-{3-[6-(piperidin-1-yl)pyridazin-3-yl]phenyl}urea
Chemical Structure Depiction of
N-(2-phenylethyl)-N'-{3-[6-(piperidin-1-yl)pyridazin-3-yl]phenyl}urea
N-(2-phenylethyl)-N'-{3-[6-(piperidin-1-yl)pyridazin-3-yl]phenyl}urea
Compound characteristics
| Compound ID: | M923-2877 |
| Compound Name: | N-(2-phenylethyl)-N'-{3-[6-(piperidin-1-yl)pyridazin-3-yl]phenyl}urea |
| Molecular Weight: | 401.51 |
| Molecular Formula: | C24 H27 N5 O |
| Smiles: | C1CCN(CC1)c1ccc(c2cccc(c2)NC(NCCc2ccccc2)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.6661 |
| logD: | 4.6657 |
| logSw: | -4.5315 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.092 |
| InChI Key: | GRHXAVZLAVEAFR-UHFFFAOYSA-N |