N-(3-chloro-4-fluorophenyl)-1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide
N-(3-chloro-4-fluorophenyl)-1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | M952-1110 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-1,2,5-trimethyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide |
| Molecular Weight: | 398.84 |
| Molecular Formula: | C16 H16 Cl F N4 O3 S |
| Smiles: | Cc1c(c(c(C)n1C)S(Nc1ccc(c(c1)[Cl])F)(=O)=O)c1nnc(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.2955 |
| logD: | 0.2295 |
| logSw: | -3.6612 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.411 |
| InChI Key: | KZSVRQJNPHYSHK-UHFFFAOYSA-N |