N-benzyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)-2,5-dimethyl-1H-pyrrole-3-sulfonamide
					Chemical Structure Depiction of
N-benzyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)-2,5-dimethyl-1H-pyrrole-3-sulfonamide
			N-benzyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)-2,5-dimethyl-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | M954-0391 | 
| Compound Name: | N-benzyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)-2,5-dimethyl-1H-pyrrole-3-sulfonamide | 
| Molecular Weight: | 360.43 | 
| Molecular Formula: | C17 H20 N4 O3 S | 
| Smiles: | CCc1nc(c2c(c(C)[nH]c2C)S(NCc2ccccc2)(=O)=O)on1 | 
| Stereo: | ACHIRAL | 
| logP: | 2.7082 | 
| logD: | 2.7039 | 
| logSw: | -3.0981 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 85.452 | 
| InChI Key: | HSKQNMNCEYYGJM-UHFFFAOYSA-N | 
 
				 
				