(8xi,9xi,10xi,13xi,14xi)-17,21-dihydroxypregn-4-ene-3,20-dione
Chemical Structure Depiction of
(8xi,9xi,10xi,13xi,14xi)-17,21-dihydroxypregn-4-ene-3,20-dione
(8xi,9xi,10xi,13xi,14xi)-17,21-dihydroxypregn-4-ene-3,20-dione
Compound characteristics
| Compound ID: | N050-0014 |
| Compound Name: | (8xi,9xi,10xi,13xi,14xi)-17,21-dihydroxypregn-4-ene-3,20-dione |
| Molecular Weight: | 346.47 |
| Molecular Formula: | C21 H30 O4 |
| Smiles: | CC12CCC(C=C2CCC2C1CCC1(C)C2CC[C@@]1(C(CO)=O)O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.4888 |
| logD: | 2.4888 |
| logSw: | -3.7171 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.269 |
| InChI Key: | WHBHBVVOGNECLV-KAKUNDDESA-N |