1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | N081-0725 |
| Compound Name: | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(4-methylphenyl)methyl]pyrrolidine-2,5-dione |
| Molecular Weight: | 367.44 |
| Molecular Formula: | C22 H25 N O4 |
| Smiles: | Cc1ccc(CC2CC(N(CCc3ccc(c(c3)OC)OC)C2=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2462 |
| logD: | 3.2462 |
| logSw: | -3.0417 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.008 |
| InChI Key: | JLEXIHYORXJGNK-SFHVURJKSA-N |