3-benzyl-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-benzyl-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidine-2,5-dione
3-benzyl-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | N081-0754 |
| Compound Name: | 3-benzyl-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidine-2,5-dione |
| Molecular Weight: | 353.42 |
| Molecular Formula: | C21 H23 N O4 |
| Smiles: | COc1ccc(CCN2C(CC(Cc3ccccc3)C2=O)=O)cc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8228 |
| logD: | 2.8228 |
| logSw: | -3.0988 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.008 |
| InChI Key: | WANPCKSMTMJOON-KRWDZBQOSA-N |