5-acetyl-N-(2,5-dimethoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide
Chemical Structure Depiction of
5-acetyl-N-(2,5-dimethoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide
5-acetyl-N-(2,5-dimethoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide
Compound characteristics
| Compound ID: | P025-0069 |
| Compound Name: | 5-acetyl-N-(2,5-dimethoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide |
| Molecular Weight: | 396.48 |
| Molecular Formula: | C17 H20 N2 O5 S2 |
| Smiles: | CC(N1CCc2c(C1)cc(s2)S(Nc1cc(ccc1OC)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3675 |
| logD: | 1.9487 |
| logSw: | -3.0468 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.432 |
| InChI Key: | MORSTPCGUVCBMG-UHFFFAOYSA-N |