N-[(4-chlorophenyl)methyl]-5-propanoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-5-propanoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide
N-[(4-chlorophenyl)methyl]-5-propanoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide
Compound characteristics
| Compound ID: | P025-0248 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-5-propanoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide |
| Molecular Weight: | 398.93 |
| Molecular Formula: | C17 H19 Cl N2 O3 S2 |
| Smiles: | CCC(N1CCc2c(C1)cc(s2)S(NCc1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4132 |
| logD: | 3.4125 |
| logSw: | -3.7934 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.069 |
| InChI Key: | MXGFQCFRJVGGCL-UHFFFAOYSA-N |