6-ethoxy-N-methyl-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Chemical Structure Depiction of
6-ethoxy-N-methyl-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
6-ethoxy-N-methyl-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Compound characteristics
| Compound ID: | P043-0083 |
| Compound Name: | 6-ethoxy-N-methyl-1-(4-methylphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide |
| Molecular Weight: | 287.32 |
| Molecular Formula: | C15 H17 N3 O3 |
| Smiles: | CCOC1=CC(C(C(NC)=O)=NN1c1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9851 |
| logD: | 1.9851 |
| logSw: | -2.3958 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.859 |
| InChI Key: | LFSXKWXVKQNKEX-UHFFFAOYSA-N |