N-(3,5-difluorophenyl)-6-ethoxy-1-(4-methoxyphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Chemical Structure Depiction of
N-(3,5-difluorophenyl)-6-ethoxy-1-(4-methoxyphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
N-(3,5-difluorophenyl)-6-ethoxy-1-(4-methoxyphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide
Compound characteristics
| Compound ID: | P043-1036 |
| Compound Name: | N-(3,5-difluorophenyl)-6-ethoxy-1-(4-methoxyphenyl)-4-oxo-1,4-dihydropyridazine-3-carboxamide |
| Molecular Weight: | 401.37 |
| Molecular Formula: | C20 H17 F2 N3 O4 |
| Smiles: | CCOC1=CC(C(C(Nc2cc(cc(c2)F)F)=O)=NN1c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0395 |
| logD: | 2.5048 |
| logSw: | -4.0978 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.658 |
| InChI Key: | YBFWEYWMPVRGFI-UHFFFAOYSA-N |