6-ethoxy-1-(4-fluorophenyl)-3-(thiomorpholine-4-carbonyl)pyridazin-4(1H)-one
Chemical Structure Depiction of
6-ethoxy-1-(4-fluorophenyl)-3-(thiomorpholine-4-carbonyl)pyridazin-4(1H)-one
6-ethoxy-1-(4-fluorophenyl)-3-(thiomorpholine-4-carbonyl)pyridazin-4(1H)-one
Compound characteristics
| Compound ID: | P043-1391 |
| Compound Name: | 6-ethoxy-1-(4-fluorophenyl)-3-(thiomorpholine-4-carbonyl)pyridazin-4(1H)-one |
| Molecular Weight: | 363.41 |
| Molecular Formula: | C17 H18 F N3 O3 S |
| Smiles: | CCOC1=CC(C(C(N2CCSCC2)=O)=NN1c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2585 |
| logD: | 2.2585 |
| logSw: | -2.5305 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.672 |
| InChI Key: | AKVIOKUBDONYKW-UHFFFAOYSA-N |