1-(2,6-dimethylphenyl)-4-{[3-(3,4-dimethylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-1,4-dihydropyrazine-2,3-dione
Chemical Structure Depiction of
1-(2,6-dimethylphenyl)-4-{[3-(3,4-dimethylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-1,4-dihydropyrazine-2,3-dione
1-(2,6-dimethylphenyl)-4-{[3-(3,4-dimethylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-1,4-dihydropyrazine-2,3-dione
Compound characteristics
| Compound ID: | P044-1016 |
| Compound Name: | 1-(2,6-dimethylphenyl)-4-{[3-(3,4-dimethylphenyl)-1,2,4-oxadiazol-5-yl]methyl}-1,4-dihydropyrazine-2,3-dione |
| Molecular Weight: | 402.45 |
| Molecular Formula: | C23 H22 N4 O3 |
| Smiles: | Cc1ccc(cc1C)c1nc(CN2C=CN(C(C2=O)=O)c2c(C)cccc2C)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.8286 |
| logD: | 3.8286 |
| logSw: | -4.0051 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.77 |
| InChI Key: | QEZUHAUCBOKMIY-UHFFFAOYSA-N |