3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-N-phenyl[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide
Chemical Structure Depiction of
3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-N-phenyl[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide
3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-N-phenyl[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide
Compound characteristics
| Compound ID: | P046-1702 |
| Compound Name: | 3-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-N-phenyl[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| Molecular Weight: | 423.83 |
| Molecular Formula: | C21 H15 Cl F N5 O2 |
| Smiles: | C(C(Nc1ccc(cc1[Cl])F)=O)c1nnc2ccc(cn12)C(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7754 |
| logD: | 2.7655 |
| logSw: | -3.566 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.989 |
| InChI Key: | ACTGILBIGSPLTK-UHFFFAOYSA-N |