methyl 5-{[(4-methylphenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate
Chemical Structure Depiction of
methyl 5-{[(4-methylphenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate
methyl 5-{[(4-methylphenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate
Compound characteristics
| Compound ID: | P048-0415 |
| Compound Name: | methyl 5-{[(4-methylphenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate |
| Molecular Weight: | 440.48 |
| Molecular Formula: | C21 H20 N4 O5 S |
| Smiles: | Cc1ccc(cc1)N(Cc1ccc(C(=O)OC)o1)S(c1ccc2nnc(C)n2c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6299 |
| logD: | 2.6299 |
| logSw: | -2.8072 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 83.088 |
| InChI Key: | RNRPRNCHBVRIOT-UHFFFAOYSA-N |