N-(3-fluorophenyl)-N-[(4-methylphenyl)methyl][1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-N-[(4-methylphenyl)methyl][1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide
N-(3-fluorophenyl)-N-[(4-methylphenyl)methyl][1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide
Compound characteristics
| Compound ID: | P048-1694 |
| Compound Name: | N-(3-fluorophenyl)-N-[(4-methylphenyl)methyl][1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| Molecular Weight: | 396.44 |
| Molecular Formula: | C20 H17 F N4 O2 S |
| Smiles: | Cc1ccc(CN(c2cccc(c2)F)S(c2ccc3nncn3c2)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.4315 |
| logD: | 3.4315 |
| logSw: | -3.5205 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.738 |
| InChI Key: | RDIWALOZSRCZIO-UHFFFAOYSA-N |