methyl N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)-N-(3-fluorophenyl)glycinate
Chemical Structure Depiction of
methyl N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)-N-(3-fluorophenyl)glycinate
methyl N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)-N-(3-fluorophenyl)glycinate
Compound characteristics
| Compound ID: | P048-1786 |
| Compound Name: | methyl N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)-N-(3-fluorophenyl)glycinate |
| Molecular Weight: | 392.41 |
| Molecular Formula: | C17 H17 F N4 O4 S |
| Smiles: | CCc1nnc2ccc(cn12)S(N(CC(=O)OC)c1cccc(c1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5756 |
| logD: | 1.5756 |
| logSw: | -2.4177 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 75.122 |
| InChI Key: | LIWKYLVZYYAEMA-UHFFFAOYSA-N |