methyl 5-{[(4-fluorophenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate
Chemical Structure Depiction of
methyl 5-{[(4-fluorophenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate
methyl 5-{[(4-fluorophenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate
Compound characteristics
| Compound ID: | P048-1926 |
| Compound Name: | methyl 5-{[(4-fluorophenyl)(3-methyl[1,2,4]triazolo[4,3-a]pyridine-6-sulfonyl)amino]methyl}furan-2-carboxylate |
| Molecular Weight: | 444.44 |
| Molecular Formula: | C20 H17 F N4 O5 S |
| Smiles: | Cc1nnc2ccc(cn12)S(N(Cc1ccc(C(=O)OC)o1)c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2356 |
| logD: | 2.2356 |
| logSw: | -2.493 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 83.088 |
| InChI Key: | JKDPSQDVMAAPAK-UHFFFAOYSA-N |