N~2~-ethyl-N~4~-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2,4-dicarboxamide
Chemical Structure Depiction of
N~2~-ethyl-N~4~-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2,4-dicarboxamide
N~2~-ethyl-N~4~-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2,4-dicarboxamide
Compound characteristics
| Compound ID: | P053-0531 |
| Compound Name: | N~2~-ethyl-N~4~-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2,4-dicarboxamide |
| Molecular Weight: | 321.37 |
| Molecular Formula: | C15 H16 F N3 O2 S |
| Smiles: | CCNC(c1nc(cs1)C(NC(C)c1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.052 |
| logD: | 2.0518 |
| logSw: | -2.6001 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.131 |
| InChI Key: | JQMRZURMCDZPGJ-VIFPVBQESA-N |