(2-methoxyphenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone
Chemical Structure Depiction of
(2-methoxyphenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone
(2-methoxyphenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | P055-0877 |
| Compound Name: | (2-methoxyphenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone |
| Molecular Weight: | 402.51 |
| Molecular Formula: | C20 H26 N4 O3 S |
| Smiles: | COc1ccccc1C(N1CCN(CC1)c1nc(CN2CCOCC2)cs1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9603 |
| logD: | 1.6666 |
| logSw: | -2.6289 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.734 |
| InChI Key: | VATFSHGBKKZLBF-UHFFFAOYSA-N |