(2,6-difluorophenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone
Chemical Structure Depiction of
(2,6-difluorophenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone
(2,6-difluorophenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | P055-0930 |
| Compound Name: | (2,6-difluorophenyl)(4-{4-[(morpholin-4-yl)methyl]-1,3-thiazol-2-yl}piperazin-1-yl)methanone |
| Molecular Weight: | 408.47 |
| Molecular Formula: | C19 H22 F2 N4 O2 S |
| Smiles: | C1COCCN1Cc1csc(n1)N1CCN(CC1)C(c1c(cccc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.323 |
| logD: | 2.0293 |
| logSw: | -2.5872 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.104 |
| InChI Key: | YFQMSTJPQZOLEQ-UHFFFAOYSA-N |