(5-benzoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)[4-(2-methylphenyl)piperazin-1-yl]methanone
					Chemical Structure Depiction of
(5-benzoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)[4-(2-methylphenyl)piperazin-1-yl]methanone
			(5-benzoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)[4-(2-methylphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | P056-0619 | 
| Compound Name: | (5-benzoyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)[4-(2-methylphenyl)piperazin-1-yl]methanone | 
| Molecular Weight: | 445.58 | 
| Molecular Formula: | C26 H27 N3 O2 S | 
| Smiles: | Cc1ccccc1N1CCN(CC1)C(c1cc2CN(CCc2s1)C(c1ccccc1)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.4293 | 
| logD: | 4.4293 | 
| logSw: | -4.2951 | 
| Hydrogen bond acceptors count: | 4 | 
| Polar surface area: | 37.175 | 
| InChI Key: | KCTQGFQUZGANBP-UHFFFAOYSA-N | 
 
				 
				