4-bromo-N-{[4-(2-ethyl-1H-imidazol-1-yl)phenyl]methyl}benzamide
Chemical Structure Depiction of
4-bromo-N-{[4-(2-ethyl-1H-imidazol-1-yl)phenyl]methyl}benzamide
4-bromo-N-{[4-(2-ethyl-1H-imidazol-1-yl)phenyl]methyl}benzamide
Compound characteristics
| Compound ID: | P060-0304 |
| Compound Name: | 4-bromo-N-{[4-(2-ethyl-1H-imidazol-1-yl)phenyl]methyl}benzamide |
| Molecular Weight: | 384.27 |
| Molecular Formula: | C19 H18 Br N3 O |
| Smiles: | CCc1nccn1c1ccc(CNC(c2ccc(cc2)[Br])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6779 |
| logD: | 3.1747 |
| logSw: | -3.8505 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.597 |
| InChI Key: | AYGZAVCCSMGBAE-UHFFFAOYSA-N |