N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-4-methoxybenzamide
Chemical Structure Depiction of
N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-4-methoxybenzamide
N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-4-methoxybenzamide
Compound characteristics
| Compound ID: | P060-1130 |
| Compound Name: | N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-4-methoxybenzamide |
| Molecular Weight: | 335.4 |
| Molecular Formula: | C20 H21 N3 O2 |
| Smiles: | [H]c1nc(C)c(C)n1c1ccc(CNC(c2ccc(cc2)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.5712 |
| logD: | 2.1559 |
| logSw: | -2.7719 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.927 |
| InChI Key: | SGXXTEWJJIDELN-UHFFFAOYSA-N |