N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-2-(thiophen-2-yl)acetamide
Chemical Structure Depiction of
N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-2-(thiophen-2-yl)acetamide
N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-2-(thiophen-2-yl)acetamide
Compound characteristics
| Compound ID: | P060-1170 |
| Compound Name: | N-{[4-(4,5-dimethyl-1H-imidazol-1-yl)phenyl]methyl}-2-(thiophen-2-yl)acetamide |
| Molecular Weight: | 325.43 |
| Molecular Formula: | C18 H19 N3 O S |
| Smiles: | [H]c1nc(C)c(C)n1c1ccc(CNC(Cc2cccs2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.9981 |
| logD: | 1.5828 |
| logSw: | -2.4094 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.188 |
| InChI Key: | FKQNRXBHTQVQAV-UHFFFAOYSA-N |