N-{1-[5-(azepan-1-yl)-1,3,4-oxadiazol-2-yl]-2-phenylethyl}-2-(2-chlorophenyl)acetamide
Chemical Structure Depiction of
N-{1-[5-(azepan-1-yl)-1,3,4-oxadiazol-2-yl]-2-phenylethyl}-2-(2-chlorophenyl)acetamide
N-{1-[5-(azepan-1-yl)-1,3,4-oxadiazol-2-yl]-2-phenylethyl}-2-(2-chlorophenyl)acetamide
Compound characteristics
| Compound ID: | P074-2934 |
| Compound Name: | N-{1-[5-(azepan-1-yl)-1,3,4-oxadiazol-2-yl]-2-phenylethyl}-2-(2-chlorophenyl)acetamide |
| Molecular Weight: | 438.96 |
| Molecular Formula: | C24 H27 Cl N4 O2 |
| Smiles: | C1CCCN(CC1)c1nnc(C(Cc2ccccc2)NC(Cc2ccccc2[Cl])=O)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7569 |
| logD: | 4.7568 |
| logSw: | -4.7768 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.439 |
| InChI Key: | ABILTUSDXUSIKQ-NRFANRHFSA-N |