N-{2-phenyl-1-[5-(thiomorpholin-4-yl)-1,3,4-oxadiazol-2-yl]ethyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{2-phenyl-1-[5-(thiomorpholin-4-yl)-1,3,4-oxadiazol-2-yl]ethyl}thiophene-2-carboxamide
N-{2-phenyl-1-[5-(thiomorpholin-4-yl)-1,3,4-oxadiazol-2-yl]ethyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | P074-3159 |
| Compound Name: | N-{2-phenyl-1-[5-(thiomorpholin-4-yl)-1,3,4-oxadiazol-2-yl]ethyl}thiophene-2-carboxamide |
| Molecular Weight: | 400.52 |
| Molecular Formula: | C19 H20 N4 O2 S2 |
| Smiles: | C(C(c1nnc(N2CCSCC2)o1)NC(c1cccs1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8554 |
| logD: | 2.8554 |
| logSw: | -3.3239 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.34 |
| InChI Key: | ASEXVYLQCHRVBC-HNNXBMFYSA-N |