3-(1-ethyl-1H-indol-5-yl)-1-[4-(2-methylpropyl)piperazin-1-yl]propan-1-one
Chemical Structure Depiction of
3-(1-ethyl-1H-indol-5-yl)-1-[4-(2-methylpropyl)piperazin-1-yl]propan-1-one
3-(1-ethyl-1H-indol-5-yl)-1-[4-(2-methylpropyl)piperazin-1-yl]propan-1-one
Compound characteristics
| Compound ID: | P091-0375 |
| Compound Name: | 3-(1-ethyl-1H-indol-5-yl)-1-[4-(2-methylpropyl)piperazin-1-yl]propan-1-one |
| Molecular Weight: | 341.5 |
| Molecular Formula: | C21 H31 N3 O |
| Smiles: | CCn1ccc2cc(CCC(N3CCN(CC3)CC(C)C)=O)ccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.4128 |
| logD: | 3.0726 |
| logSw: | -3.4753 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 22.0067 |
| InChI Key: | ACOPUVJKTOKMIC-UHFFFAOYSA-N |