N-[(2-methoxyphenyl)methyl]-2-[4-(3-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-[(2-methoxyphenyl)methyl]-2-[4-(3-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide
N-[(2-methoxyphenyl)methyl]-2-[4-(3-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | P113-1017 |
| Compound Name: | N-[(2-methoxyphenyl)methyl]-2-[4-(3-methoxyphenyl)piperazin-1-yl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 438.55 |
| Molecular Formula: | C23 H26 N4 O3 S |
| Smiles: | COc1cccc(c1)N1CCN(CC1)c1nc(cs1)C(NCc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5548 |
| logD: | 4.5547 |
| logSw: | -4.3848 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.359 |
| InChI Key: | GKNIMLOISMQVQD-UHFFFAOYSA-N |