N-cyclopentyl-2-{3-[(4-methoxyphenyl)carbamamido]-6-methyl-2-oxopyridin-1(2H)-yl}acetamide
					Chemical Structure Depiction of
N-cyclopentyl-2-{3-[(4-methoxyphenyl)carbamamido]-6-methyl-2-oxopyridin-1(2H)-yl}acetamide
			N-cyclopentyl-2-{3-[(4-methoxyphenyl)carbamamido]-6-methyl-2-oxopyridin-1(2H)-yl}acetamide
Compound characteristics
| Compound ID: | P121-0918 | 
| Compound Name: | N-cyclopentyl-2-{3-[(4-methoxyphenyl)carbamamido]-6-methyl-2-oxopyridin-1(2H)-yl}acetamide | 
| Molecular Weight: | 398.46 | 
| Molecular Formula: | C21 H26 N4 O4 | 
| Smiles: | CC1=CC=C(C(N1CC(NC1CCCC1)=O)=O)NC(Nc1ccc(cc1)OC)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.8623 | 
| logD: | 2.8617 | 
| logSw: | -3.3974 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 80.8 | 
| InChI Key: | HBSRDTWCHLZVLF-UHFFFAOYSA-N | 
 
				 
				