2-ethyl-5-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-7-methyl[1,3]thiazolo[4,5-d]pyridazin-4(5H)-one
Chemical Structure Depiction of
2-ethyl-5-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-7-methyl[1,3]thiazolo[4,5-d]pyridazin-4(5H)-one
2-ethyl-5-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-7-methyl[1,3]thiazolo[4,5-d]pyridazin-4(5H)-one
Compound characteristics
| Compound ID: | P124-0629 |
| Compound Name: | 2-ethyl-5-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}-7-methyl[1,3]thiazolo[4,5-d]pyridazin-4(5H)-one |
| Molecular Weight: | 415.49 |
| Molecular Formula: | C20 H22 F N5 O2 S |
| Smiles: | CCc1nc2C(N(CC(N3CCN(CC3)c3ccc(cc3)F)=O)N=C(C)c2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6565 |
| logD: | 2.6564 |
| logSw: | -2.7869 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.655 |
| InChI Key: | MKTBXNIKVLOLFF-UHFFFAOYSA-N |