N-(4-ethoxyphenyl)-N'-{3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}urea
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-N'-{3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}urea
N-(4-ethoxyphenyl)-N'-{3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}urea
Compound characteristics
| Compound ID: | P130-0115 |
| Compound Name: | N-(4-ethoxyphenyl)-N'-{3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}urea |
| Molecular Weight: | 403.48 |
| Molecular Formula: | C23 H25 N5 O2 |
| Smiles: | CCOc1ccc(cc1)NC(Nc1cccc(c1)c1c(nccn1)N1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0945 |
| logD: | 5.0945 |
| logSw: | -4.8223 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.011 |
| InChI Key: | YKAYCOAHSNBGGX-UHFFFAOYSA-N |