N-(2,3-dihydro-1H-inden-5-yl)-N'-{3-[3-(morpholin-4-yl)pyrazin-2-yl]phenyl}urea
Chemical Structure Depiction of
N-(2,3-dihydro-1H-inden-5-yl)-N'-{3-[3-(morpholin-4-yl)pyrazin-2-yl]phenyl}urea
N-(2,3-dihydro-1H-inden-5-yl)-N'-{3-[3-(morpholin-4-yl)pyrazin-2-yl]phenyl}urea
Compound characteristics
| Compound ID: | P130-0593 |
| Compound Name: | N-(2,3-dihydro-1H-inden-5-yl)-N'-{3-[3-(morpholin-4-yl)pyrazin-2-yl]phenyl}urea |
| Molecular Weight: | 415.49 |
| Molecular Formula: | C24 H25 N5 O2 |
| Smiles: | C1Cc2ccc(cc2C1)NC(Nc1cccc(c1)c1c(nccn1)N1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7966 |
| logD: | 4.7966 |
| logSw: | -4.7642 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.716 |
| InChI Key: | SHMOGKDVXKXXFR-UHFFFAOYSA-N |