N-(4-methoxy-2-methylphenyl)-N'-{3-[3-(thiomorpholin-4-yl)pyrazin-2-yl]phenyl}urea
Chemical Structure Depiction of
N-(4-methoxy-2-methylphenyl)-N'-{3-[3-(thiomorpholin-4-yl)pyrazin-2-yl]phenyl}urea
N-(4-methoxy-2-methylphenyl)-N'-{3-[3-(thiomorpholin-4-yl)pyrazin-2-yl]phenyl}urea
Compound characteristics
| Compound ID: | P130-0681 |
| Compound Name: | N-(4-methoxy-2-methylphenyl)-N'-{3-[3-(thiomorpholin-4-yl)pyrazin-2-yl]phenyl}urea |
| Molecular Weight: | 435.55 |
| Molecular Formula: | C23 H25 N5 O2 S |
| Smiles: | Cc1cc(ccc1NC(Nc1cccc(c1)c1c(nccn1)N1CCSCC1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.5974 |
| logD: | 4.5974 |
| logSw: | -4.4293 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.367 |
| InChI Key: | UUJGEIKYQIWSEX-UHFFFAOYSA-N |