N-[1-(4-fluorophenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide
Chemical Structure Depiction of
N-[1-(4-fluorophenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide
N-[1-(4-fluorophenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide
Compound characteristics
| Compound ID: | P131-0412 |
| Compound Name: | N-[1-(4-fluorophenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide |
| Molecular Weight: | 390.46 |
| Molecular Formula: | C23 H23 F N4 O |
| Smiles: | CC(c1ccc(cc1)F)NC(c1cccc(c1)c1c(nccn1)N1CCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7855 |
| logD: | 3.7854 |
| logSw: | -3.9036 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.161 |
| InChI Key: | UKYLOLBZIQWLEZ-INIZCTEOSA-N |