N-[1-(4-ethoxyphenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide
Chemical Structure Depiction of
N-[1-(4-ethoxyphenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide
N-[1-(4-ethoxyphenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide
Compound characteristics
| Compound ID: | P131-0413 |
| Compound Name: | N-[1-(4-ethoxyphenyl)ethyl]-3-[3-(pyrrolidin-1-yl)pyrazin-2-yl]benzamide |
| Molecular Weight: | 416.52 |
| Molecular Formula: | C25 H28 N4 O2 |
| Smiles: | CCOc1ccc(cc1)C(C)NC(c1cccc(c1)c1c(nccn1)N1CCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1254 |
| logD: | 4.1254 |
| logSw: | -4.1351 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.285 |
| InChI Key: | MZFPXLHFYCOPDN-SFHVURJKSA-N |