[4-(2-fluorophenyl)piperazin-1-yl]{4-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}methanone
Chemical Structure Depiction of
[4-(2-fluorophenyl)piperazin-1-yl]{4-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}methanone
[4-(2-fluorophenyl)piperazin-1-yl]{4-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}methanone
Compound characteristics
| Compound ID: | P132-0297 |
| Compound Name: | [4-(2-fluorophenyl)piperazin-1-yl]{4-[3-(pyrrolidin-1-yl)pyrazin-2-yl]phenyl}methanone |
| Molecular Weight: | 431.51 |
| Molecular Formula: | C25 H26 F N5 O |
| Smiles: | C1CCN(C1)c1c(c2ccc(cc2)C(N2CCN(CC2)c2ccccc2F)=O)nccn1 |
| Stereo: | ACHIRAL |
| logP: | 3.5825 |
| logD: | 3.5825 |
| logSw: | -3.6332 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 42.192 |
| InChI Key: | OLDQAKMHTBOCTR-UHFFFAOYSA-N |