3-[3-(3-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(trifluoromethyl)phenyl]methyl}propanamide
Chemical Structure Depiction of
3-[3-(3-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(trifluoromethyl)phenyl]methyl}propanamide
3-[3-(3-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(trifluoromethyl)phenyl]methyl}propanamide
Compound characteristics
| Compound ID: | P149-1647 |
| Compound Name: | 3-[3-(3-fluorophenyl)-1,2-oxazol-4-yl]-N-{[4-(trifluoromethyl)phenyl]methyl}propanamide |
| Molecular Weight: | 392.35 |
| Molecular Formula: | C20 H16 F4 N2 O2 |
| Smiles: | C(Cc1conc1c1cccc(c1)F)C(NCc1ccc(cc1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3356 |
| logD: | 4.3356 |
| logSw: | -4.466 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.438 |
| InChI Key: | OQAZAISMFDOLKA-UHFFFAOYSA-N |