3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one
Chemical Structure Depiction of
3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one
3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one
Compound characteristics
| Compound ID: | P149-1912 |
| Compound Name: | 3-[3-(2-fluorophenyl)-1,2-oxazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one |
| Molecular Weight: | 409.46 |
| Molecular Formula: | C23 H24 F N3 O3 |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(CCc1conc1c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6195 |
| logD: | 3.6192 |
| logSw: | -3.7596 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 51.163 |
| InChI Key: | UNYTVHSQGRREBQ-UHFFFAOYSA-N |