ethyl 8-bromo-3-methyl-4,5-dioxo-2-{[(propan-2-yl)amino]methyl}-4,5-dihydro-3H-benzo[e]indole-1-carboxylate
Chemical Structure Depiction of
ethyl 8-bromo-3-methyl-4,5-dioxo-2-{[(propan-2-yl)amino]methyl}-4,5-dihydro-3H-benzo[e]indole-1-carboxylate
ethyl 8-bromo-3-methyl-4,5-dioxo-2-{[(propan-2-yl)amino]methyl}-4,5-dihydro-3H-benzo[e]indole-1-carboxylate
Compound characteristics
| Compound ID: | P160-0083 |
| Compound Name: | ethyl 8-bromo-3-methyl-4,5-dioxo-2-{[(propan-2-yl)amino]methyl}-4,5-dihydro-3H-benzo[e]indole-1-carboxylate |
| Molecular Weight: | 433.3 |
| Molecular Formula: | C20 H21 Br N2 O4 |
| Smiles: | CCOC(c1c2c3cc(ccc3C(C(c2n(C)c1CNC(C)C)=O)=O)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.1997 |
| logD: | 1.37 |
| logSw: | -3.7432 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.667 |
| InChI Key: | CTUUBTBKLMYVCY-UHFFFAOYSA-N |