N-(3,5-dimethoxyphenyl)-2-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide
N-(3,5-dimethoxyphenyl)-2-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide
Compound characteristics
| Compound ID: | P162-0703 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-[5-(3-methylthiophen-2-yl)-1,3,4-oxadiazol-2-yl]acetamide |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C17 H17 N3 O4 S |
| Smiles: | Cc1ccsc1c1nnc(CC(Nc2cc(cc(c2)OC)OC)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.8995 |
| logD: | 2.8994 |
| logSw: | -3.2821 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.404 |
| InChI Key: | UKJKCVVALQPUEY-UHFFFAOYSA-N |