N-(2-ethylphenyl)-7-hydroxy-4-methyl-5-oxo-4,5-dihydrothieno[3,2-b]pyridine-6-carboxamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-7-hydroxy-4-methyl-5-oxo-4,5-dihydrothieno[3,2-b]pyridine-6-carboxamide
N-(2-ethylphenyl)-7-hydroxy-4-methyl-5-oxo-4,5-dihydrothieno[3,2-b]pyridine-6-carboxamide
Compound characteristics
| Compound ID: | P163-0278 |
| Compound Name: | N-(2-ethylphenyl)-7-hydroxy-4-methyl-5-oxo-4,5-dihydrothieno[3,2-b]pyridine-6-carboxamide |
| Molecular Weight: | 328.39 |
| Molecular Formula: | C17 H16 N2 O3 S |
| Smiles: | CCc1ccccc1NC(C1=C(c2c(ccs2)N(C)C1=O)O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5846 |
| logD: | -3.5712 |
| logSw: | -3.0435 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.861 |
| InChI Key: | XNPYPQDGNAOJEU-UHFFFAOYSA-N |