N-(5-chloro-2-methylphenyl)-1-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-1-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide
N-(5-chloro-2-methylphenyl)-1-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | P168-0468 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-1-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| Molecular Weight: | 313.78 |
| Molecular Formula: | C17 H16 Cl N3 O |
| Smiles: | CCn1cc(C(Nc2cc(ccc2C)[Cl])=O)c2cccnc12 |
| Stereo: | ACHIRAL |
| logP: | 3.1786 |
| logD: | 3.1784 |
| logSw: | -3.4789 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.267 |
| InChI Key: | PKMNNNIYHCWASF-UHFFFAOYSA-N |