2-chloro-N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-5-(methylsulfanyl)benzamide
Chemical Structure Depiction of
2-chloro-N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-5-(methylsulfanyl)benzamide
2-chloro-N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-5-(methylsulfanyl)benzamide
Compound characteristics
| Compound ID: | P169-0020 |
| Compound Name: | 2-chloro-N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-5-(methylsulfanyl)benzamide |
| Molecular Weight: | 366.89 |
| Molecular Formula: | C15 H15 Cl N4 O S2 |
| Smiles: | Cc1c(CNC(c2cc(ccc2[Cl])SC)=O)n2c(n1)sc(C)n2 |
| Stereo: | ACHIRAL |
| logP: | 3.2663 |
| logD: | 3.2663 |
| logSw: | -3.7359 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.319 |
| InChI Key: | DTHIJSSVXINAEP-UHFFFAOYSA-N |