2-methyl-N-(4-methylphenyl)-5-(1H-pyrazol-5-yl)furan-3-sulfonamide
Chemical Structure Depiction of
2-methyl-N-(4-methylphenyl)-5-(1H-pyrazol-5-yl)furan-3-sulfonamide
2-methyl-N-(4-methylphenyl)-5-(1H-pyrazol-5-yl)furan-3-sulfonamide
Compound characteristics
| Compound ID: | P174-0119 |
| Compound Name: | 2-methyl-N-(4-methylphenyl)-5-(1H-pyrazol-5-yl)furan-3-sulfonamide |
| Molecular Weight: | 317.36 |
| Molecular Formula: | C15 H15 N3 O3 S |
| Smiles: | Cc1ccc(cc1)NS(c1cc(c2ccn[nH]2)oc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9092 |
| logD: | 2.8953 |
| logSw: | -3.399 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.543 |
| InChI Key: | IHPWHCFUYCHGHJ-UHFFFAOYSA-N |